C16H19N3O5S — CID 32563567
N-[4-oxo-4-[(3-sulfamoylphenyl)methylamino]butyl]furan-2-carboxamide (PubChem CID 32563567) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[4-oxo-4-[(3-sulfamoylphenyl)methylamino]butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-[(3-sulfamoylphenyl)methylamino]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 32563567 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[4-oxo-4-[(3-sulfamoylphenyl)methylamino]butyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(CNC(=O)CCCNC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C16H19N3O5S/c17-25(22,23)13-5-1-4-12(10-13)11-19-15(20)7-2-8-18-16(21)14-6-3-9-24-14/h1,3-6,9-10H,2,7-8,11H2,(H,18,21)(H,19,20)(H2,17,22,23) |
| InChIKey | WBLVTTSKOAXUKY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|