C15H17N3O3 — CID 35511874
N-[4-oxo-4-(pyridin-3-ylmethylamino)butyl]furan-2-carboxamide (PubChem CID 35511874) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[4-oxo-4-(pyridin-3-ylmethylamino)butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-(pyridin-3-ylmethylamino)butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35511874 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[4-oxo-4-(pyridin-3-ylmethylamino)butyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)NCc1cccnc1 |
| InChI | InChI=1S/C15H17N3O3/c19-14(18-11-12-4-1-7-16-10-12)6-2-8-17-15(20)13-5-3-9-21-13/h1,3-5,7,9-10H,2,6,8,11H2,(H,17,20)(H,18,19) |
| InChIKey | BGENWAQMSFSBKW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|