C10H14N2O6S2 — CID 60859947
3-[(3-sulfamoylphenyl)methylsulfamoyl]propanoic acid (PubChem CID 60859947) has the molecular formula C10H14N2O6S2 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[(3-sulfamoylphenyl)methylsulfamoyl]propanoic acid.
| Compound Name | 3-[(3-sulfamoylphenyl)methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60859947 |
| Molecular Formula | C10H14N2O6S2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3-[(3-sulfamoylphenyl)methylsulfamoyl]propanoic acid |
| SMILES | NS(=O)(=O)c1cccc(CNS(=O)(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C10H14N2O6S2/c11-20(17,18)9-3-1-2-8(6-9)7-12-19(15,16)5-4-10(13)14/h1-3,6,12H,4-5,7H2,(H,13,14)(H2,11,17,18) |
| InChIKey | XEZVLGNCOHPXMV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |