C16H18N2O4S2 — CID 55906600
3-[[2-(4-methylphenyl)ethenylsulfonylamino]methyl]benzenesulfonamide (PubChem CID 55906600) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[[2-(4-methylphenyl)ethenylsulfonylamino]methyl]benzenesulfonamide.
| Compound Name | 3-[[2-(4-methylphenyl)ethenylsulfonylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55906600 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-[[2-(4-methylphenyl)ethenylsulfonylamino]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C=CS(=O)(=O)NCc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-13-5-7-14(8-6-13)9-10-23(19,20)18-12-15-3-2-4-16(11-15)24(17,21)22/h2-11,18H,12H2,1H3,(H2,17,21,22) |
| InChIKey | AHGHROLVECHIRE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |