C11H13NO6S — CID 28514143
3-(1,3-benzodioxol-5-ylmethylsulfamoyl)propanoic acid (PubChem CID 28514143) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 28514143 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13NO6S/c13-11(14)3-4-19(15,16)12-6-8-1-2-9-10(5-8)18-7-17-9/h1-2,5,12H,3-4,6-7H2,(H,13,14) |
| InChIKey | KDRAKHLIOKPPRT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |