C11H16N2O4S — CID 106333551
2-(1,3-benzodioxol-5-ylmethylamino)-N-methylethanesulfonamide (PubChem CID 106333551) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-methylethanesulfonamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106333551 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H16N2O4S/c1-12-18(14,15)5-4-13-7-9-2-3-10-11(6-9)17-8-16-10/h2-3,6,12-13H,4-5,7-8H2,1H3 |
| InChIKey | FIFCSPUHIWLQCF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|