C12H17N3O4S — CID 106333609
N-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]ethanesulfonamide (PubChem CID 106333609) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]ethanesulfonamide.
| Compound Name | N-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106333609 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-methyl-2-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylamino]ethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H17N3O4S/c1-13-20(17,18)5-4-14-7-9-2-3-11-10(6-9)15-12(16)8-19-11/h2-3,6,13-14H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | OQMYTYIENIZIBG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|