C14H17N5O2 — CID 103075578
6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 103075578) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103075578 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cn1cnnc1CCNCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H17N5O2/c1-19-9-16-18-13(19)4-5-15-7-10-2-3-12-11(6-10)17-14(20)8-21-12/h2-3,6,9,15H,4-5,7-8H2,1H3,(H,17,20) |
| InChIKey | OQPBBJYBXGMCPO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|