C13H18N2O2S — CID 103075592
6-[(3-methylsulfanylpropylamino)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 103075592) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-[(3-methylsulfanylpropylamino)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(3-methylsulfanylpropylamino)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103075592 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-[(3-methylsulfanylpropylamino)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CSCCCNCc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H18N2O2S/c1-18-6-2-5-14-8-10-3-4-12-11(7-10)15-13(16)9-17-12/h3-4,7,14H,2,5-6,8-9H2,1H3,(H,15,16) |
| InChIKey | KHCQQUDJMRSAFA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|