C14H18N4O — CID 63332725
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 63332725) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 63332725 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cn1cnnc1CCNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H18N4O/c1-18-10-16-17-14(18)4-6-15-9-11-2-3-13-12(8-11)5-7-19-13/h2-3,8,10,15H,4-7,9H2,1H3 |
| InChIKey | LHBYXOISHSPLMP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|