C18H22N2O — CID 43804179
4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]-N,N-dimethylaniline (PubChem CID 43804179) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 43804179 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CNCc2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-20(2)17-6-3-14(4-7-17)12-19-13-15-5-8-18-16(11-15)9-10-21-18/h3-8,11,19H,9-10,12-13H2,1-2H3 |
| InChIKey | PLCQIMNUQLZDHP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|