C17H20N2O — CID 115213219
[4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]phenyl]methanamine (PubChem CID 115213219) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is [4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]phenyl]methanamine.
| Compound Name | [4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 115213219 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [4-[(2,3-dihydro-1-benzofuran-5-ylmethylamino)methyl]phenyl]methanamine |
| SMILES | NCc1ccc(CNCc2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C17H20N2O/c18-10-13-1-3-14(4-2-13)11-19-12-15-5-6-17-16(9-15)7-8-20-17/h1-6,9,19H,7-8,10-12,18H2 |
| InChIKey | DFOJFFNKSYQKQD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|