C12H18N2O2 — CID 115121424
1-amino-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-2-ol (PubChem CID 115121424) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-amino-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-2-ol.
| Compound Name | 1-amino-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 115121424 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-amino-3-(2,3-dihydro-1-benzofuran-5-ylmethylamino)propan-2-ol |
| SMILES | NCC(O)CNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H18N2O2/c13-6-11(15)8-14-7-9-1-2-12-10(5-9)3-4-16-12/h1-2,5,11,14-15H,3-4,6-8,13H2 |
| InChIKey | ICFAELXLRRNRLY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|