C10H13NOS — CID 59518007
(2,3-dihydro-1-benzofuran-5-ylmethylamino)methanethiol (PubChem CID 59518007) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is (2,3-dihydro-1-benzofuran-5-ylmethylamino)methanethiol.
| Compound Name | (2,3-dihydro-1-benzofuran-5-ylmethylamino)methanethiol |
|---|---|
| PubChem CID | 59518007 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2,3-dihydro-1-benzofuran-5-ylmethylamino)methanethiol |
| SMILES | SCNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H13NOS/c13-7-11-6-8-1-2-10-9(5-8)3-4-12-10/h1-2,5,11,13H,3-4,6-7H2 |
| InChIKey | BNIJNTVQPBLKTI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|