C9H10OS — CID 79885132
2,3-dihydro-1-benzofuran-5-ylmethanethiol (PubChem CID 79885132) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-ylmethanethiol.
| Compound Name | 2,3-dihydro-1-benzofuran-5-ylmethanethiol |
|---|---|
| PubChem CID | 79885132 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-5-ylmethanethiol |
| SMILES | SCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H10OS/c11-6-7-1-2-9-8(5-7)3-4-10-9/h1-2,5,11H,3-4,6H2 |
| InChIKey | XVUFDETZPHITBG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|