C10H11BrMgO — CID 156847219
magnesium;5-ethyl-2,3-dihydro-1-benzofuran;bromide (PubChem CID 156847219) has the molecular formula C10H11BrMgO and a molecular weight of 251.41 g/mol. Its IUPAC name is magnesium;5-ethyl-2,3-dihydro-1-benzofuran;bromide.
| Compound Name | magnesium;5-ethyl-2,3-dihydro-1-benzofuran;bromide |
|---|---|
| PubChem CID | 156847219 |
| Molecular Formula | C10H11BrMgO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | magnesium;5-ethyl-2,3-dihydro-1-benzofuran;bromide |
| SMILES | [Br-].[CH2-]Cc1ccc2c(c1)CCO2.[Mg+2] |
| InChI | InChI=1S/C10H11O.BrH.Mg/c1-2-8-3-4-10-9(7-8)5-6-11-10;;/h3-4,7H,1-2,5-6H2;1H;/q-1;;+2/p-1 |
| InChIKey | LFKJICRIKDIHTJ-UHFFFAOYSA-M |
| XLogP | -1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|