C10H9O3- — CID 7130264
2-(2,3-dihydro-1-benzofuran-5-yl)acetate (PubChem CID 7130264) has the molecular formula C10H9O3- and a molecular weight of 177.18 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)acetate.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetate |
|---|---|
| PubChem CID | 7130264 |
| Molecular Formula | C10H9O3- |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetate |
| SMILES | O=C([O-])Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H10O3/c11-10(12)6-7-1-2-9-8(5-7)3-4-13-9/h1-2,5H,3-4,6H2,(H,11,12)/p-1 |
| InChIKey | LALSYIKKTXUSLG-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |