C9H12NO+ — CID 6932006
2,3-dihydro-1-benzofuran-5-ylmethylazanium (PubChem CID 6932006) has the molecular formula C9H12NO+ and a molecular weight of 150.20 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-ylmethylazanium.
| Compound Name | 2,3-dihydro-1-benzofuran-5-ylmethylazanium |
|---|---|
| PubChem CID | 6932006 |
| Molecular Formula | C9H12NO+ |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-5-ylmethylazanium |
| SMILES | [NH3+]Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H11NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5H,3-4,6,10H2/p+1 |
| InChIKey | WQXWNTPLZFVZNX-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |