C9H9ClO — CID 11789614
5-(chloromethyl)-2,3-dihydro-1-benzofuran (PubChem CID 11789614) has the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(chloromethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 11789614 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 5-(chloromethyl)-2,3-dihydro-1-benzofuran |
| SMILES | ClCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H9ClO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5H,3-4,6H2 |
| InChIKey | SWPANFDAIKLKBD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|