C12H12ClN3O — CID 121208805
4-(chloromethyl)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)triazole (PubChem CID 121208805) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)triazole.
| Compound Name | 4-(chloromethyl)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)triazole |
|---|---|
| PubChem CID | 121208805 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-(chloromethyl)-1-(2,3-dihydro-1-benzofuran-5-ylmethyl)triazole |
| SMILES | ClCc1cn(Cc2ccc3c(c2)CCO3)nn1 |
| InChI | InChI=1S/C12H12ClN3O/c13-6-11-8-16(15-14-11)7-9-1-2-12-10(5-9)3-4-17-12/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | BDNMOIPWHWHTQU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|