C12H16N2O — CID 65244917
1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azetidin-3-amine (PubChem CID 65244917) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azetidin-3-amine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azetidin-3-amine |
|---|---|
| PubChem CID | 65244917 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azetidin-3-amine |
| SMILES | NC1CN(Cc2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C12H16N2O/c13-11-7-14(8-11)6-9-1-2-12-10(5-9)3-4-15-12/h1-2,5,11H,3-4,6-8,13H2 |
| InChIKey | QDKLICOYUDCGPU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |