C11H15NO2 — CID 115229208
[2,3-dihydro-1-benzofuran-5-ylmethyl(methyl)amino]methanol (PubChem CID 115229208) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is [2,3-dihydro-1-benzofuran-5-ylmethyl(methyl)amino]methanol.
| Compound Name | [2,3-dihydro-1-benzofuran-5-ylmethyl(methyl)amino]methanol |
|---|---|
| PubChem CID | 115229208 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [2,3-dihydro-1-benzofuran-5-ylmethyl(methyl)amino]methanol |
| SMILES | CN(CO)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H15NO2/c1-12(8-13)7-9-2-3-11-10(6-9)4-5-14-11/h2-3,6,13H,4-5,7-8H2,1H3 |
| InChIKey | HOKKEUIFYMSLJG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|