C10H9NO — CID 10986528
2-(2,3-dihydro-1-benzofuran-5-yl)acetonitrile (PubChem CID 10986528) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)acetonitrile.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetonitrile |
|---|---|
| PubChem CID | 10986528 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetonitrile |
| SMILES | N#CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H9NO/c11-5-3-8-1-2-10-9(7-8)4-6-12-10/h1-2,7H,3-4,6H2 |
| InChIKey | XMZGPMWFOOVMGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |