C14H17NO — CID 82471341
5-(3,4-dihydro-2H-chromen-6-yl)pentanenitrile (PubChem CID 82471341) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-chromen-6-yl)pentanenitrile.
| Compound Name | 5-(3,4-dihydro-2H-chromen-6-yl)pentanenitrile |
|---|---|
| PubChem CID | 82471341 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 5-(3,4-dihydro-2H-chromen-6-yl)pentanenitrile |
| SMILES | N#CCCCCc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H17NO/c15-9-3-1-2-5-12-7-8-14-13(11-12)6-4-10-16-14/h7-8,11H,1-6,10H2 |
| InChIKey | UNEUPONZXGQXNQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|