C12H14N2O — CID 117043556
2-(2,3-dihydro-1-benzofuran-5-yl)ethyl-methylcyanamide (PubChem CID 117043556) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)ethyl-methylcyanamide.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethyl-methylcyanamide |
|---|---|
| PubChem CID | 117043556 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)ethyl-methylcyanamide |
| SMILES | CN(C#N)CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H14N2O/c1-14(9-13)6-4-10-2-3-12-11(8-10)5-7-15-12/h2-3,8H,4-7H2,1H3 |
| InChIKey | XKBYKPHTWVGLDT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|