C11H11NO — CID 83481552
5-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran (PubChem CID 83481552) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 5-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 83481552 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H11NO/c1-12-6-4-9-2-3-11-10(8-9)5-7-13-11/h2-3,8H,4-7H2 |
| InChIKey | ABPOGVMSNALCMH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|