C13H15NO — CID 176776889
5-(2-isocyanobutyl)-2,3-dihydro-1-benzofuran (PubChem CID 176776889) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-(2-isocyanobutyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(2-isocyanobutyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 176776889 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-(2-isocyanobutyl)-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]C(CC)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C13H15NO/c1-3-12(14-2)9-10-4-5-13-11(8-10)6-7-15-13/h4-5,8,12H,3,6-7,9H2,1H3 |
| InChIKey | OFWIJWHHBQSQNV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|