C11H11FO3 — CID 81357256
3-(2,3-dihydro-1-benzofuran-5-yl)-2-fluoropropanoic acid (PubChem CID 81357256) has the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-2-fluoropropanoic acid.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 81357256 |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-2-fluoropropanoic acid |
| SMILES | O=C(O)C(F)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H11FO3/c12-9(11(13)14)6-7-1-2-10-8(5-7)3-4-15-10/h1-2,5,9H,3-4,6H2,(H,13,14) |
| InChIKey | QFUXEBYWTRWOTL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |