(2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid

C11H13NO3 — CID 62717626

IUPAC(2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid
SMILESN[C@@H](Cc1ccc2c(c1)CCO2)C(=O)O
InChIInChI=1S/C11H13NO3/c12-9(11(13)14)6-7-1-2-10-8(5-7)3-4-15-10/h1-2,5,9H,3-4,6,12H2,(H,13,14)/t9-/m0/s1
InChIKeyHKGMTLHJHVAQAL-VIFPVBQESA-N
MW207.23 g/mol
LogP0.58
Rot. Bonds3

About (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid

(2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid (PubChem CID 62717626) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid
PubChem CID62717626
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name(2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid
SMILESN[C@@H](Cc1ccc2c(c1)CCO2)C(=O)O
InChIInChI=1S/C11H13NO3/c12-9(11(13)14)6-7-1-2-10-8(5-7)3-4-15-10/h1-2,5,9H,3-4,6,12H2,(H,13,14)/t9-/m0/s1
InChIKeyHKGMTLHJHVAQAL-VIFPVBQESA-N
XLogP0.58
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid (CID 62717626) is (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid is N[C@@H](Cc1ccc2c(c1)CCO2)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid?
The InChIKey is HKGMTLHJHVAQAL-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13NO3/c12-9(11(13)14)6-7-1-2-10-8(5-7)3-4-15-10/h1-2,5,9H,3-4,6,12H2,(H,13,14)/t9-/m0/s1.
What are the key properties of (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid?
(2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid has a molecular weight of 207.23 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(2,3-dihydro-1-benzofuran-5-yl)propanoic acid is sourced from PubChem (CID 62717626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).