C11H14BNO4 — CID 177060122
(2S)-2-amino-3-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)propanoic acid (PubChem CID 177060122) has the molecular formula C11H14BNO4 and a molecular weight of 235.05 g/mol. Its IUPAC name is (2S)-2-amino-3-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 177060122 |
| Molecular Formula | C11H14BNO4 |
| Molecular Weight | 235.05 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (2S)-2-amino-3-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-6-yl)propanoic acid |
| SMILES | N[C@@H](Cc1ccc2c(c1)CCOB2O)C(=O)O |
| InChI | InChI=1S/C11H14BNO4/c13-10(11(14)15)6-7-1-2-9-8(5-7)3-4-17-12(9)16/h1-2,5,10,16H,3-4,6,13H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | GKLNZRBGVWBZHA-JTQLQIEISA-N |
| XLogP | -1.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.05 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|