C11H13NO4 — CID 82392055
2-amino-3-(4H-1,3-benzodioxin-7-yl)propanoic acid (PubChem CID 82392055) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-amino-3-(4H-1,3-benzodioxin-7-yl)propanoic acid.
| Compound Name | 2-amino-3-(4H-1,3-benzodioxin-7-yl)propanoic acid |
|---|---|
| PubChem CID | 82392055 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-amino-3-(4H-1,3-benzodioxin-7-yl)propanoic acid |
| SMILES | NC(Cc1ccc2c(c1)OCOC2)C(=O)O |
| InChI | InChI=1S/C11H13NO4/c12-9(11(13)14)3-7-1-2-8-5-15-6-16-10(8)4-7/h1-2,4,9H,3,5-6,12H2,(H,13,14) |
| InChIKey | VJQKKRFDJKIHRG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |