C10H12O5S — CID 59816088
2-(2,3-dihydro-1-benzofuran-5-yl)-1-hydroxyethanesulfonic acid (PubChem CID 59816088) has the molecular formula C10H12O5S and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-1-hydroxyethanesulfonic acid.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 59816088 |
| Molecular Formula | C10H12O5S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1-hydroxyethanesulfonic acid |
| SMILES | O=S(=O)(O)C(O)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H12O5S/c11-10(16(12,13)14)6-7-1-2-9-8(5-7)3-4-15-9/h1-2,5,10-11H,3-4,6H2,(H,12,13,14) |
| InChIKey | XVFRHHRRIXZZSR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|