C16H15ClO2 — CID 62505676
2-(3-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanol (PubChem CID 62505676) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanol.
| Compound Name | 2-(3-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanol |
|---|---|
| PubChem CID | 62505676 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H15ClO2/c17-14-3-1-2-11(8-14)9-15(18)12-4-5-16-13(10-12)6-7-19-16/h1-5,8,10,15,18H,6-7,9H2 |
| InChIKey | YAIQCDFVKVDTNH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |