C14H14O3 — CID 83171228
1-(2,3-dihydro-1-benzofuran-5-yl)-2-(furan-2-yl)ethanol (PubChem CID 83171228) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(furan-2-yl)ethanol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 83171228 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(furan-2-yl)ethanol |
| SMILES | OC(Cc1ccco1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H14O3/c15-13(9-12-2-1-6-16-12)10-3-4-14-11(8-10)5-7-17-14/h1-4,6,8,13,15H,5,7,9H2 |
| InChIKey | AVBHNBMYRGXDLP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |