C12H14O2 — CID 79734096
1-(2,3-dihydro-1-benzofuran-5-yl)but-3-en-1-ol (PubChem CID 79734096) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)but-3-en-1-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 79734096 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)but-3-en-1-ol |
| SMILES | C=CCC(O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H14O2/c1-2-3-11(13)9-4-5-12-10(8-9)6-7-14-12/h2,4-5,8,11,13H,1,3,6-7H2 |
| InChIKey | CBUSNSBLVYEUEY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|