C12H16O3 — CID 103454434
1-(2,3-dihydro-1-benzofuran-5-yl)butane-1,2-diol (PubChem CID 103454434) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)butane-1,2-diol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 103454434 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)butane-1,2-diol |
| SMILES | CCC(O)C(O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H16O3/c1-2-10(13)12(14)9-3-4-11-8(7-9)5-6-15-11/h3-4,7,10,12-14H,2,5-6H2,1H3 |
| InChIKey | PMTCHWWEZZNNER-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |