C11H14O3S — CID 170820027
1-(2,3-dihydro-1-benzofuran-5-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170820027) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820027 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H14O3S/c12-9(6-15)11(13)8-1-2-10-7(5-8)3-4-14-10/h1-2,5,9,11-13,15H,3-4,6H2 |
| InChIKey | NAXUYNZCEFPFSL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|