C10H13NO2 — CID 66513598
(2R)-2-amino-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol (PubChem CID 66513598) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol.
| Compound Name | (2R)-2-amino-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol |
|---|---|
| PubChem CID | 66513598 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2R)-2-amino-2-(2,3-dihydro-1-benzofuran-5-yl)ethanol |
| SMILES | N[C@@H](CO)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H13NO2/c11-9(6-12)7-1-2-10-8(5-7)3-4-13-10/h1-2,5,9,12H,3-4,6,11H2/t9-/m0/s1 |
| InChIKey | BMTOGQCQAFGHSS-VIFPVBQESA-N |
| XLogP | 0.61 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |