C11H16N2O2 — CID 116942432
2,3-diamino-3-(2,3-dihydro-1-benzofuran-5-yl)propan-1-ol (PubChem CID 116942432) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,3-diamino-3-(2,3-dihydro-1-benzofuran-5-yl)propan-1-ol.
| Compound Name | 2,3-diamino-3-(2,3-dihydro-1-benzofuran-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 116942432 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2,3-diamino-3-(2,3-dihydro-1-benzofuran-5-yl)propan-1-ol |
| SMILES | NC(CO)C(N)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H16N2O2/c12-9(6-14)11(13)8-1-2-10-7(5-8)3-4-15-10/h1-2,5,9,11,14H,3-4,6,12-13H2 |
| InChIKey | YZMYYMQCYODEPT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |