C14H20N2O2 — CID 54927378
6-amino-6-(2,3-dihydro-1-benzofuran-5-yl)hexanamide (PubChem CID 54927378) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-amino-6-(2,3-dihydro-1-benzofuran-5-yl)hexanamide.
| Compound Name | 6-amino-6-(2,3-dihydro-1-benzofuran-5-yl)hexanamide |
|---|---|
| PubChem CID | 54927378 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 6-amino-6-(2,3-dihydro-1-benzofuran-5-yl)hexanamide |
| SMILES | NC(=O)CCCCC(N)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H20N2O2/c15-12(3-1-2-4-14(16)17)10-5-6-13-11(9-10)7-8-18-13/h5-6,9,12H,1-4,7-8,15H2,(H2,16,17) |
| InChIKey | URUVJTYHGZXGRM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|