C12H14N2O — CID 116940064
4-amino-4-(2,3-dihydro-1-benzofuran-5-yl)butanenitrile (PubChem CID 116940064) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-amino-4-(2,3-dihydro-1-benzofuran-5-yl)butanenitrile.
| Compound Name | 4-amino-4-(2,3-dihydro-1-benzofuran-5-yl)butanenitrile |
|---|---|
| PubChem CID | 116940064 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4-amino-4-(2,3-dihydro-1-benzofuran-5-yl)butanenitrile |
| SMILES | N#CCCC(N)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H14N2O/c13-6-1-2-11(14)9-3-4-12-10(8-9)5-7-15-12/h3-4,8,11H,1-2,5,7,14H2 |
| InChIKey | KOWXBSPWRLNSEI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |