C12H14N2O2 — CID 116939964
4-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)butanenitrile (PubChem CID 116939964) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)butanenitrile.
| Compound Name | 4-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)butanenitrile |
|---|---|
| PubChem CID | 116939964 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)butanenitrile |
| SMILES | N#CCCC(N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14N2O2/c13-5-1-2-10(14)9-3-4-11-12(8-9)16-7-6-15-11/h3-4,8,10H,1-2,6-7,14H2 |
| InChIKey | WQMGNNIGLVQDHI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |