C13H20N2O2 — CID 171226610
(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentane-1,5-diamine (PubChem CID 171226610) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171226610 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H20N2O2/c14-6-2-1-3-11(15)10-4-5-12-13(9-10)17-8-7-16-12/h4-5,9,11H,1-3,6-8,14-15H2/t11-/m0/s1 |
| InChIKey | RPUKUSCZRVFIMR-NSHDSACASA-N |
| XLogP | 1.59 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|