C16H23NO4 — CID 60861991
ethyl 6-amino-6-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate (PubChem CID 60861991) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl 6-amino-6-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate.
| Compound Name | ethyl 6-amino-6-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate |
|---|---|
| PubChem CID | 60861991 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 6-amino-6-(2,3-dihydro-1,4-benzodioxin-6-yl)hexanoate |
| SMILES | CCOC(=O)CCCCC(N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H23NO4/c1-2-19-16(18)6-4-3-5-13(17)12-7-8-14-15(11-12)21-10-9-20-14/h7-8,11,13H,2-6,9-10,17H2,1H3 |
| InChIKey | NIGXGCSCSRULKL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|