C10H10Cl2N2 — CID 86705554
(4R)-4-amino-4-(3,4-dichlorophenyl)butanenitrile (PubChem CID 86705554) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is (4R)-4-amino-4-(3,4-dichlorophenyl)butanenitrile.
| Compound Name | (4R)-4-amino-4-(3,4-dichlorophenyl)butanenitrile |
|---|---|
| PubChem CID | 86705554 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (4R)-4-amino-4-(3,4-dichlorophenyl)butanenitrile |
| SMILES | N#CCC[C@@H](N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2/c11-8-4-3-7(6-9(8)12)10(14)2-1-5-13/h3-4,6,10H,1-2,14H2/t10-/m1/s1 |
| InChIKey | NJOXFZBEKLRZJC-SNVBAGLBSA-N |
| XLogP | 3.30 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |