C8H10Cl3NO — CID 74889971
(2S)-2-amino-2-(3,4-dichlorophenyl)ethanol;hydrochloride (PubChem CID 74889971) has the molecular formula C8H10Cl3NO and a molecular weight of 242.53 g/mol. Its IUPAC name is (2S)-2-amino-2-(3,4-dichlorophenyl)ethanol;hydrochloride.
| Compound Name | (2S)-2-amino-2-(3,4-dichlorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 74889971 |
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | (2S)-2-amino-2-(3,4-dichlorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@H](CO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2NO.ClH/c9-6-2-1-5(3-7(6)10)8(11)4-12;/h1-3,8,12H,4,11H2;1H/t8-;/m1./s1 |
| InChIKey | MHVBQPIPUIGSRB-DDWIOCJRSA-N |
| XLogP | 2.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |