C10H14ClNO — CID 166687598
2-amino-2-(4-chloro-3-ethylphenyl)ethanol (PubChem CID 166687598) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-amino-2-(4-chloro-3-ethylphenyl)ethanol.
| Compound Name | 2-amino-2-(4-chloro-3-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 166687598 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-amino-2-(4-chloro-3-ethylphenyl)ethanol |
| SMILES | CCc1cc(C(N)CO)ccc1Cl |
| InChI | InChI=1S/C10H14ClNO/c1-2-7-5-8(10(12)6-13)3-4-9(7)11/h3-5,10,13H,2,6,12H2,1H3 |
| InChIKey | IPZOBZFQQKPGIO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |