C11H10Cl2N2O2 — CID 154330372
[3-cyano-1-(3,4-dichlorophenyl)propyl]carbamic acid (PubChem CID 154330372) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is [3-cyano-1-(3,4-dichlorophenyl)propyl]carbamic acid.
| Compound Name | [3-cyano-1-(3,4-dichlorophenyl)propyl]carbamic acid |
|---|---|
| PubChem CID | 154330372 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | [3-cyano-1-(3,4-dichlorophenyl)propyl]carbamic acid |
| SMILES | N#CCCC(NC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-8-4-3-7(6-9(8)13)10(2-1-5-14)15-11(16)17/h3-4,6,10,15H,1-2H2,(H,16,17) |
| InChIKey | WPUQSBZMYSBOOX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |