C10H9Cl2NO3 — CID 78961882
(3R)-3-(3,4-dichlorophenyl)-3-formamidopropanoic acid (PubChem CID 78961882) has the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. Its IUPAC name is (3R)-3-(3,4-dichlorophenyl)-3-formamidopropanoic acid.
| Compound Name | (3R)-3-(3,4-dichlorophenyl)-3-formamidopropanoic acid |
|---|---|
| PubChem CID | 78961882 |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (3R)-3-(3,4-dichlorophenyl)-3-formamidopropanoic acid |
| SMILES | O=CN[C@H](CC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NO3/c11-7-2-1-6(3-8(7)12)9(13-5-14)4-10(15)16/h1-3,5,9H,4H2,(H,13,14)(H,15,16)/t9-/m1/s1 |
| InChIKey | UKXQMUPADHLBFC-SECBINFHSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|