3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid

C13H15Cl2NO3 — CID 119221515

IUPAC3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid
SMILESCC(CC(=O)O)NC(=O)C(C)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H15Cl2NO3/c1-7(5-12(17)18)16-13(19)8(2)9-3-4-10(14)11(15)6-9/h3-4,6-8H,5H2,1-2H3,(H,16,19)(H,17,18)
InChIKeyUCXAVVRANWKJCY-UHFFFAOYSA-N
MW304.17 g/mol
LogP3.08
Rot. Bonds5

About 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid

3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid (PubChem CID 119221515) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid.

Molecular Properties

Compound Name3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid
PubChem CID119221515
Molecular FormulaC13H15Cl2NO3
Molecular Weight304.17 g/mol
Exact Mass303.04
IUPAC Name3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid
SMILESCC(CC(=O)O)NC(=O)C(C)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C13H15Cl2NO3/c1-7(5-12(17)18)16-13(19)8(2)9-3-4-10(14)11(15)6-9/h3-4,6-8H,5H2,1-2H3,(H,16,19)(H,17,18)
InChIKeyUCXAVVRANWKJCY-UHFFFAOYSA-N
XLogP3.08
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.17
LogP ≤ 53.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid?
The IUPAC name of 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid (CID 119221515) is 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid.
What is the SMILES notation for 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid?
The canonical SMILES for 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid is CC(CC(=O)O)NC(=O)C(C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid?
The InChIKey is UCXAVVRANWKJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO3/c1-7(5-12(17)18)16-13(19)8(2)9-3-4-10(14)11(15)6-9/h3-4,6-8H,5H2,1-2H3,(H,16,19)(H,17,18).
What are the key properties of 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid?
3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid has a molecular weight of 304.17 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dichlorophenyl)propanoylamino]butanoic acid is sourced from PubChem (CID 119221515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).